On Target OPRK_HUMAN 0.48958334/CHEMBL198867
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.48958334, the most similar ligand is CHEMBL198867. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL198867 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | O=C1N(CC2CO2)c3ccccc3C14CCN(CC5CCCCCCC5)CC4 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 00024002 01005200 00101100 00010600 20000080 00002040 02000000 20000100 00200880 000808c0 083c0024 50039000 05008002 00100000 400a1140 000c000a 10048000 02000000 08802008 00000201 40100500 18300610 33002080 81500019 00000001 80000200 08800010 10001081 04088200 0006000b 00022080 20802600 |