On Target ALDR_HUMAN 0.38610038/CHEMBL294612
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.38610038, the most similar ligand is CHEMBL294612. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL294612 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | C[C@H]1C[C@]2(NC(=O)NC2=O)c3cc(Cl)cnc3O1 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 14058002 0d80f018 2010410a 01810f10 80141100 82018100 04006004 0a403604 00410a00 002900c8 09340004 4001b8c0 0780980a 00200800 f1000301 001c200c 90244008 0200a504 00e00448 00020001 c0020140 38358f00 218000c0 915c0018 00050803 c0000600 08100200 90000000 0c400300 00064003 a4086000 84020e40 |