On Target AA1R_HUMAN 0.44036698/CHEMBL242633
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.44036698, the most similar ligand is CHEMBL242633. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL242633 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | Cc1cccc(c1)n2cc3c4ccccc4nc(NC(=O)Cc5ccccc5)c3n2 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 0000400e 80000608 20185100 00010620 200c1040 00004010 06000000 00101000 00100100 a00908c0 09380004 40019000 01008802 00f00000 400600c1 000c000c 18040080 0200400c 09600000 40a62404 40100000 1c218638 21802800 83600011 00140002 80000000 08010080 00000880 04408008 0046080b 40043000 802247a0 |