On Target AOFB_HUMAN 0.41304347/CHEMBL2333929
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.41304347, the most similar ligand is CHEMBL2333929. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL2333929 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | C[C@H](Cc1ccc(OCCCCCCNc2c3CCCCc3nc4cc(Cl)ccc24)cc1)N(C)CC#C |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 0401c00a 01004008 6010410a 10810710 204c3120 02002040 0b04a000 00100001 10400880 000808d0 08308004 40818800 02800806 00e00800 11120041 020c200e 00848200 0600000c 08602408 00020201 44100100 18248118 21814000 81500010 00046000 80000001 08128040 10001080 04488206 00860002 000400a0 20420640 |