On Target ACM1_HUMAN 0.5450237/CHEMBL3310802
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.5450237, the most similar ligand is CHEMBL3310802. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL3310802 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | CCOC(=O)N1CCC(CN2CCC3(CC2)CN(C(=O)N(C)C)c4ncccc34)CC1.OC(=O)\C=C\C(=O)O |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 00004006 01405200 00184100 01800e10 20041200 0000a002 02002004 20102405 01600a00 200900c0 00380024 50138000 00009802 00100800 00020100 001e000c 00068008 02084024 08210c18 00a00241 40100100 1c258e50 20822800 91700018 00151000 00001102 08400090 10201080 04408218 0006080b 84081080 20006700 |