On Target GRM5_HUMAN 0.49029127/CHEMBL3925795
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.49029127, the most similar ligand is CHEMBL3925795. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL3925795 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | COC1C(=O)N(CC1(C)C)c2ccc(cn2)C#Cc3cncc(Cl)c3 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 1002c202 00025828 00187980 00010610 284430a0 00002010 00000000 00500000 00000000 200000c0 003d0004 4003d804 0600980a 00108000 800a1800 000c000c 10240000 82004004 08a00008 00a00201 40100000 1c908700 33802881 02600018 00040804 00000200 08a00280 10000081 02408208 00060801 00001000 00820300 |