On Target P2RX3_HUMAN 0.51046026/CHEMBL3679789
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.51046026, the most similar ligand is CHEMBL3679789. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL3679789 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | CC(C)C(=O)C1C(N(C(=O)C1=O)c2ccc(cc2)c3ccsc3)c4cccnc4N5CCOCC5 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 1003e002 0180d820 00107902 80810610 20161180 00102050 43006000 22001180 04500900 200808c0 013c0204 5001f080 0e00980a 00308801 80021549 000c010c 10068000 03004007 0c202418 00a00201 c0100100 5c068e90 32812800 00700018 00841c00 c4100080 08000080 900010c4 0048c30a 00060803 20005080 e0c10600 |