On Target P2Y12_HUMAN 0.47598255/CHEMBL2402268
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.47598255, the most similar ligand is CHEMBL2402268. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL2402268 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | CCOC(=O)c1cnc(N2CCN(CC2CCC(=O)O)C(=O)Nc3ccccc3)c(Cl)c1 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 0003c006 11803800 001041a0 84080e10 201c1010 00006000 00000004 28502009 10000100 20020ac0 00280004 40019800 0600b81a 0111a000 80020940 121c000c 00060010 1a404004 08610008 00a00201 c0100100 3e058f40 21822821 0271001e 00150c00 00002600 08080080 10000080 0cc08218 00060801 c0081000 00824a00 |