On Target NOS2_HUMAN 0.38235295/CHEMBL112866
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.38235295, the most similar ligand is CHEMBL112866. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL112866 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | COc1ccnc(NC2CCN(CC2)C(=O)c3ccc(Cl)cc3)c1 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 0000c002 81001c08 20104108 00010600 20040000 00000000 00000000 22101008 00000000 200809e0 00200004 50018800 02008846 08000000 01020400 0004000c 00040080 02004004 08200000 00a42201 60100000 1c0e8700 20800800 0070001c 00002000 c0000000 00040080 90000080 00008318 00060811 a0041000 002a0200 |