On Target SCN9A_HUMAN 0.5181818/CHEMBL1779920
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.5181818, the most similar ligand is CHEMBL1779920. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL1779920 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | OC1(CC(=O)c2occc2)C(=O)N(Cc3ccc(Cl)cc3)c4ccccc14 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 0043c00a 01a00800 80181102 00010600 20000080 00006048 03000000 22201000 02304980 000808c0 083800a4 4001d900 57088c46 00300000 40020560 000a0008 1004c000 02000000 08400008 00000201 c0101500 18248720 23012040 815c021d 00002810 e0000200 0c040010 98041080 04088182 00060013 e4042080 60c20600 |