On Target PRGR_HUMAN 0.4450262/CHEMBL324499
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.4450262, the most similar ligand is CHEMBL324499. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL324499 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | Clc1cccc(c1)c2ccc3NC(=O)C4(CCC4)c3c2 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 0001e002 01000800 00100102 00810600 20001001 00002000 05000000 00000000 00000800 000808c0 08380024 40019800 07008004 00308010 c0020140 00080008 00068000 02001000 0c000008 00002001 40100100 18220700 31002000 81500011 00002000 80000280 00000010 100050c1 0400c000 00060003 00002080 20020600 |