On Target CXCR1_HUMAN 0.34126985/CHEMBL556862
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.34126985, the most similar ligand is CHEMBL556862. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL556862 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | CC[C@@H](NC1=C(Nc2cccc(C(=O)N3CCCC3C(=O)O)c2O)C(=O)C1=O)c4ccccc4 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 1041c00a 01005808 60100102 00012600 20090081 68022010 020000a0 22401500 05a00c40 001808d0 08380004 5043b000 0e008812 01200000 800a0440 10086048 10050001 22008000 08630210 20020201 48100980 18168e00 23000000 0050801c 04041000 c0000080 20400010 900c0580 20508102 20060003 a4045420 40002600 |