On Target PGH2_HUMAN 0.40807176/CHEMBL95469
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.40807176, the most similar ligand is CHEMBL95469. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL95469 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | COc1ccc2c(c1)c(CC(=O)Nc3ccc(NC(=O)C)cc3)c(C)n2C(=O)c4ccc(Cl)cc4 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 0000c002 00001a08 20100188 51010718 20045020 00000000 060c2000 00001000 80500000 000908c0 08280004 4001b800 13008866 00708000 c1020041 0204000c 00850200 83800004 09280400 00020200 40100000 18268718 20806001 91500015 00042000 c0000100 08160000 10000080 04008204 0006004b 80042200 00020620 |