On Target TRY1_HUMAN 0.41666666/CHEMBL138709
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.41666666, the most similar ligand is CHEMBL138709. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL138709 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | NC(=N)c1ccc2[nH]cc(CC(=O)Nc3ccc(cn3)c4ccccc4S(=O)(=O)N)c2c1 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 0000e012 00808801 01184180 41b10610 20041000 04000008 00002000 00101000 00400108 20090843 08382004 60009800 93008800 00508001 c0320840 800c0004 00060080 02004004 0c200400 00a02002 c0100000 1c228608 30802800 99600019 0004200d 80080080 480002c0 000000c8 0440c008 20060843 40047200 00010720 |