On Target ACE_HUMAN 0.53333336/CHEMBL44077
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.53333336, the most similar ligand is CHEMBL44077. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL44077 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | OC(=O)CN1C(=O)[C@H](CCc2ccccc12)N[C@@H](Cc3c[nH]c4ccccc34)C(=O)O |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 00014002 01004a00 00101122 45810610 20041080 00002040 03002000 20100100 00500880 08090ac0 08382024 4001b000 1e008802 00702803 801a0040 000c000e 10248000 02000000 08600408 00000201 40100100 38208e08 23802041 9350001a 00043801 80000080 08000010 10001080 0c088000 0006000b 20045280 20402620 |