On Target 5HT1B_HUMAN 0.47474748/CHEMBL420475
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.47474748, the most similar ligand is CHEMBL420475. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL420475 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | CN1CCC(CC1)c2c[nH]c3ccc(NC(=O)C4CCC4)nc23 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 00014002 01800a00 00184180 40810610 200c1240 00002000 0000a000 20100000 00400800 200800c0 08380004 5001b000 0c008802 00500810 00060840 00040004 08040000 02004008 08600400 00a00205 40100100 5c008608 21802840 80700010 00042000 80000000 08008080 10000084 00008008 0006180b 00041200 00000720 |