On Target TLR4_HUMAN 0.2901961/CHEMBL4068003
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.2901961, the most similar ligand is CHEMBL4068003. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL4068003 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | Cn1c2C(=O)N(C(=Nc2c3cc(ccc13)c4ccccc4)SCC(=O)NC5CCCCC5)c6ccccc6 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 0000200a 01801200 201841a0 08112702 000d0040 0000c060 00008102 20001000 06560100 420248e0 0130000c 40018000 00009806 00e40080 100c00c0 000c0004 0c020008 02008204 06602020 00000213 c0000080 18048678 31900841 85780018 22000000 90000000 2000c048 10040040 24604000 00460049 400c0200 022107c0 |