On Target CNR2_HUMAN 0.5470086/CHEMBL1082330
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.5470086, the most similar ligand is CHEMBL1082330. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL1082330 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | CN1c2nc(c(cc2C(CC1(C)C)C(=O)NCO)c3ccc(Cl)cc3)c4ccc(Cl)cc4Cl |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 0003e002 01004a01 80104182 11810610 21041320 1400a068 11002000 0c180000 00600b00 300908d1 00322084 40039800 07008804 00308c00 60020800 821c000c 00068000 06007004 0c200418 10e00003 45100500 1c22a740 31800800 91708030 00043001 81080280 080402c0 100050e1 0448c00c 00060c0b 80003880 23820600 |