On Target MTOR_HUMAN 0.4488889/CHEMBL3693557
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.4488889, the most similar ligand is CHEMBL3693557. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL3693557 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | C[C@H]1COCCN1c2nc(nc3nc(ccc23)c4ccc(Cl)cc4)N5CCC(CC5)C(=O)N |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 0003e002 01800821 00187100 98090600 020400a8 00004000 0000b000 20180880 10200100 300008c0 00240004 50039800 06009806 00900000 00021048 1a0c010c 10060800 02006000 0c600000 00e00201 40100020 1c048760 33806840 80700014 10002400 80000000 080480c0 100000c1 0040c20c 00460c00 c0001800 038202c0 |