On Target FYN_HUMAN 0.41968912/CHEMBL1998121
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.41968912, the most similar ligand is CHEMBL1998121. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL1998121 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | NCCC(C(=O)Nc1ccc2[nH]ncc2c1)c3ccc(Cl)c(Cl)c3 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 0002c002 04000208 20100100 00010600 20040000 00002000 06000000 00000000 00200800 000808c0 08380004 40029800 07008026 00500000 c0020040 0004000c 00040000 02000008 08600000 00220405 40100100 1c200708 20802800 816c0011 00102000 80100000 00040000 10000080 04008000 0006000b 00002000 00024620 |