On Target CAH2_HUMAN 0.35222673/CHEMBL52550
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.35222673, the most similar ligand is CHEMBL52550. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL52550 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | NS(=O)(=O)c1cc(ccc1Cl)C(=O)N[C@@H](Cc2c[nH]cn2)C(=O)N[C@@H](Cc3ccccc3)C(=O)O |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 04008012 00807801 01104100 05b10610 040003e0 00010000 00002020 2200100c 01400980 00094ac0 2830a000 7000b800 06008846 00102801 813a0480 000c010c 10000000 0e000000 00410018 40002201 a0000d00 38228f00 23000041 9b40001c 00043800 c0080200 00040000 90000108 0c000104 2046000b e0044000 60032620 |