On Target 5HT2C_HUMAN 0.52061856/CHEMBL203025
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.52061856, the most similar ligand is CHEMBL203025. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL203025 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | Clc1ccc2CC3CNCCN3c2n1 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 0000c002 02004200 00104120 05800610 00041200 00000040 0a002000 20100000 00400880 200902c0 00300004 40001880 03000826 00002800 40020100 001c0004 00248000 02004004 08200408 00a00201 40100500 3e308100 20800821 93600012 00044000 00000200 08040080 10005080 0c488018 0006080a 00003080 20020600 |