On Target HRH1_HUMAN 0.47761193/CHEMBL2158834
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.47761193, the most similar ligand is CHEMBL2158834. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL2158834 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | OC(=O)c1cccnc1N2CCC(CN3CCC(CC3)Oc4ccc(Cl)c(Cl)c4)CC2 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 1401c002 01800808 20104108 00010610 20041000 02016040 92000000 20100000 00a00100 200008c0 00200004 50039800 06808806 00000002 01020003 000c200e 00240000 02004404 08a00000 00a20201 c0100000 1c048b40 21800880 0070001c 00042001 00100000 08100080 10001080 00408208 00060800 c0001000 00022240 |