On Target IKKB_HUMAN 0.45454547/CHEMBL3823257
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.45454547, the most similar ligand is CHEMBL3823257. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL3823257 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | COC(=O)C(=C)CC1(O)C(=O)Nc2ccccc12 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 00054002 01000000 00101112 00010700 20280080 00006000 01000000 00000400 11000900 001a08c2 083800a4 4001d000 05008030 01300000 40020144 00080008 0086c000 02000000 18400018 00000001 40100100 18200e20 23002000 81500011 00000000 80000200 08000010 90001080 04008200 80060003 44002080 20410610 |