On Target MK03_HUMAN 0.31365314/CHEMBL213618
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.31365314, the most similar ligand is CHEMBL213618. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL213618 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | CNc1nccc(n1)c2ccc(s2)C(=O)N[C@H](CN)Cc3ccc(Cl)cc3Cl |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 0001a042 00003a10 82110101 40050600 01000204 00024020 000c2080 1e0e500e 00800d80 000908c1 08328204 60008b80 82008836 00100420 00022400 000c0205 03071000 0200600c 04610000 10a00209 00001500 7d22a780 34802840 9b40011c 02002100 c4000200 01040000 80002264 0c18031c 0046080b e0000800 00c306a1 |