On Target NMDZ1_HUMAN 0.23333333/CHEMBL419399
For the given ligand MIe-421, we have found in our database that, being scored 0.23333333, the most similar ligand is CHEMBL419399. Check out the elaboration below.
| MIe-421 (Given Ligand) | CHEMBL419399 (Similar Ligand) |
|---|---|
| NC(=O)C3Oc1ccccc1C2CC23 | Cc1ccc(CC2CCN(CC#Cc3ccc4[nH]c(O)nc4c3)CC2)cc1 |
|
|
|
|
|
|
| 04010000 01000018 6000010a 00010702 00081000 82000000 02000000 00000200 00110800 000808c0 08140000 4001d040 0480800a 01200000 11001001 00082008 00800000 a2028000 00402000 00020001 00000100 18040610 03000040 00400410 00000000 c0000000 00000008 00000000 00000302 00064002 00000000 00400400 | 00000202 01020810 00120902 040d0600 00442040 00004000 00000000 20100020 00100900 000808c0 09308004 50018800 00000002 00600000 60100140 000c000c 00000000 02000024 00200000 00000201 40020100 18900020 21890001 02500010 00000084 80000000 00000240 10000000 03400000 00460002 40000020 040006a0 |