On Target PDE5A_HUMAN 0.41007194/CHEMBL190423
For the given ligand MIe-421, we have found in our database that, being scored 0.41007194, the most similar ligand is CHEMBL190423. Check out the elaboration below.
| MIe-421 (Given Ligand) | CHEMBL190423 (Similar Ligand) |
|---|---|
| NC(=O)C3Oc1ccccc1C2CC23 | CCc1cc(C(=O)C)c(O)cc1OCc2cccc(c2)C(=O)NCCCCCCCCC(=O)O |
|
|
|
|
|
|
| 04010000 01000018 6000010a 00010702 00081000 82000000 02000000 00000200 00110800 000808c0 08140000 4001d040 0480800a 01200000 11001001 00082008 00800000 a2028000 00402000 00020001 00000100 18040610 03000040 00400410 00000000 c0000000 00000008 00000000 00000302 00064002 00000000 00400400 | 04010001 01001808 20100109 00010600 00081001 80024000 52040000 22001200 00000100 00080ac0 48200000 40019000 0480880a 00810000 01000401 0a082008 00000000 02008000 00402000 40020a01 00000000 18068e30 01000000 00d0101c 00004000 c0002000 08120000 90800000 00010300 00060003 e0060004 00000600 |