On Target TRPV1_RAT 0.41732284/CHEMBL101775
For the given ligand MIe-421, we have found in our database that, being scored 0.41732284, the most similar ligand is CHEMBL101775. Check out the elaboration below.
| MIe-421 (Given Ligand) | CHEMBL101775 (Similar Ligand) |
|---|---|
| NC(=O)C3Oc1ccccc1C2CC23 | COc1cc(CC(=O)NCC(CCc2ccccc2)COC(=O)C(C)(C)C)ccc1O |
|
|
|
|
|
|
| 04010000 01000018 6000010a 00010702 00081000 82000000 02000000 00000200 00110800 000808c0 08140000 4001d040 0480800a 01200000 11001001 00082008 00800000 a2028000 00402000 00020001 00000100 18040610 03000040 00400410 00000000 c0000000 00000008 00000000 00000302 00064002 00000000 00400400 | 00000040 43001008 2010010a 00010700 00081000 80000000 02000000 20000000 00100880 000808c0 08300000 40019000 0100c002 20280000 41000001 00089008 00a20000 02000000 00c80000 00020201 00000120 18340e00 01000080 81500018 00000401 80000000 00120000 10010000 04000200 00060007 00002000 00002600 |