On Target PAR1_HUMAN 0.36241612/CHEMBL80942
For the given ligand MIe-421, we have found in our database that, being scored 0.36241612, the most similar ligand is CHEMBL80942. Check out the elaboration below.
| MIe-421 (Given Ligand) | CHEMBL80942 (Similar Ligand) |
|---|---|
| NC(=O)C3Oc1ccccc1C2CC23 | OC(=O)C[C@H](NC(=O)[C@@H]1CCCN(C1)C(=O)CCC2CCNCC2)c3ccc4OCOc4c3 |
|
|
|
|
|
|
| 04010000 01000018 6000010a 00010702 00081000 82000000 02000000 00000200 00110800 000808c0 08140000 4001d040 0480800a 01200000 11001001 00082008 00800000 a2028000 00402000 00020001 00000100 18040610 03000040 00400410 00000000 c0000000 00000008 00000000 00000302 00064002 00000000 00400400 | 00010000 47801408 20100108 00010600 00001000 40000000 02040000 22001000 00200800 000809e0 48300000 50019000 0c00c81a 20000000 01000401 00288008 00000000 02000001 00c82018 00020201 80040300 181c8e30 010000c0 00548018 40001801 c0000000 00320000 b0000000 01000300 00060013 20040000 00012600 |