On Target MK01_HUMAN 0.4528302/CHEMBL1909070
For the given ligand MIe-421, we have found in our database that, being scored 0.4528302, the most similar ligand is CHEMBL1909070. Check out the elaboration below.
| MIe-421 (Given Ligand) | CHEMBL1909070 (Similar Ligand) |
|---|---|
| NC(=O)C3Oc1ccccc1C2CC23 | CC(C)(Oc1ccc(cc1)C2CCCc3ccccc23)C(=O)O |
|
|
|
|
|
|
| 04010000 01000018 6000010a 00010702 00081000 82000000 02000000 00000200 00110800 000808c0 08140000 4001d040 0480800a 01200000 11001001 00082008 00800000 a2028000 00402000 00020001 00000100 18040610 03000040 00400410 00000000 c0000000 00000008 00000000 00000302 00064002 00000000 00400400 | 04000000 01000008 2000010a 00010200 00001000 00000002 02040400 01000001 00000800 00080840 08140000 4000d000 00808002 00200000 01200001 00080008 00000200 82000000 00102000 00020001 00000100 08000a00 05004000 08400010 00000000 a0000001 00120008 40800000 02000282 00020002 00000000 00000400 |