On Target AMPN_HUMAN 0.37209302/CHEMBL1941150
For the given ligand MIe-421, we have found in our database that, being scored 0.37209302, the most similar ligand is CHEMBL1941150. Check out the elaboration below.
| MIe-421 (Given Ligand) | CHEMBL1941150 (Similar Ligand) |
|---|---|
| NC(=O)C3Oc1ccccc1C2CC23 | CC(C)C[C@H](NC(=O)[C@@H](O)[C@H](N)Cc1ccccc1)C(=O)N2CCC[C@H]2C(=O)N3CCC[C@H]3C(=O)O |
|
|
|
|
|
|
| 04010000 01000018 6000010a 00010702 00081000 82000000 02000000 00000200 00110800 000808c0 08140000 4001d040 0480800a 01200000 11001001 00082008 00800000 a2028000 00402000 00020001 00000100 18040610 03000040 00400410 00000000 c0000000 00000008 00000000 00000302 00064002 00000000 00400400 | 00010000 01007400 00100102 04010600 00080080 00000010 00000000 20000008 00100800 000809c0 08300000 4001f000 0e008012 01202003 80180000 00080008 10000000 02000000 00400000 00000201 00000100 38040e20 03000043 83500018 00000000 80000000 00000000 10000000 0c000000 00060013 20004000 00402600 |