On Target ADRB2_HUMAN 0.5123967/CHEMBL1201237
For the given ligand MIe-421, we have found in our database that, being scored 0.5123967, the most similar ligand is CHEMBL1201237. Check out the elaboration below.
| MIe-421 (Given Ligand) | CHEMBL1201237 (Similar Ligand) |
|---|---|
| NC(=O)C3Oc1ccccc1C2CC23 | CC(C)(C)NC[C@H](O)COc1cccc2C(=O)CCCc12 |
|
|
|
|
|
|
| 04010000 01000018 6000010a 00010702 00081000 82000000 02000000 00000200 00110800 000808c0 08140000 4001d040 0480800a 01200000 11001001 00082008 00800000 a2028000 00402000 00020001 00000100 18040610 03000040 00400410 00000000 c0000000 00000008 00000000 00000302 00064002 00000000 00400400 | 04010000 43000808 2010010a 00010600 00001080 c2008000 02000000 00000201 00000810 00080840 08300000 40009040 04808002 20200080 01204001 20082008 10200200 22008000 00882000 00020201 00400100 18020240 07004080 08400414 00000001 c0000001 00000000 00800000 00000302 00064002 80000000 00400640 |