On Target GLRA3_HUMAN 0.19480519/CHEMBL4070615
For the given ligand MIe-421, we have found in our database that, being scored 0.19480519, the most similar ligand is CHEMBL4070615. Check out the elaboration below.
| MIe-421 (Given Ligand) | CHEMBL4070615 (Similar Ligand) |
|---|---|
| NC(=O)C3Oc1ccccc1C2CC23 | C[C@H]1[C@@H]2[C@H](CN1S(=O)(=O)c3ccc4OCOc4c3)c5cnccc5N(C)C2=O |
|
|
|
|
|
|
| 04010000 01000018 6000010a 00010702 00081000 82000000 02000000 00000200 00110800 000808c0 08140000 4001d040 0480800a 01200000 11001001 00082008 00800000 a2028000 00402000 00020001 00000100 18040610 03000040 00400410 00000000 c0000000 00000008 00000000 00000302 00064002 00000000 00400400 | 00020052 23804608 2110410a 01b00610 200c1700 00042050 0301a000 20040000 00600880 004909e0 40382034 60039000 0c00c803 10300801 81e20201 0024800e 000ce004 02000004 00680c18 00027e03 e0140300 18248600 20804000 99410018 42041800 0108000c 08828010 3000108c 05480600 20060a1b 00000080 20812670 |