On Target CHLE_HUMAN 0.46846846/CHEMBL263785
For the given ligand MIe-421, we have found in our database that, being scored 0.46846846, the most similar ligand is CHEMBL263785. Check out the elaboration below.
| MIe-421 (Given Ligand) | CHEMBL263785 (Similar Ligand) |
|---|---|
| NC(=O)C3Oc1ccccc1C2CC23 | CCCOc1ccccc1C[N+](C)(CC)CCCCCC(=O)N(C)CCCCCCCCN(C)C(=O)CCCCC[N+](C)(CC)Cc2ccccc2OCCC |
|
|
|
|
|
|
| 04010000 01000018 6000010a 00010702 00081000 82000000 02000000 00000200 00110800 000808c0 08140000 4001d040 0480800a 01200000 11001001 00082008 00800000 a2028000 00402000 00020001 00000100 18040610 03000040 00400410 00000000 c0000000 00000008 00000000 00000302 00064002 00000000 00400400 | 04010000 01001008 20100108 00010600 00001000 02000100 02000000 22001400 00000000 001008c0 08200000 40019000 0480880a 00000000 01000401 00082008 00000000 22008000 00002000 00020201 00000040 18048610 01000000 00500018 00000000 c0000000 00000000 90000000 00000300 00060001 24060000 00002200 |