On Target ACM4_HUMAN 0.5/CHEMBL1910856
For the given ligand MIe-421, we have found in our database that, being scored 0.5, the most similar ligand is CHEMBL1910856. Check out the elaboration below.
| MIe-421 (Given Ligand) | CHEMBL1910856 (Similar Ligand) |
|---|---|
| NC(=O)C3Oc1ccccc1C2CC23 | CC(C)(CCC(C(=O)N)(c1ccccc1)c2ccccc2)N3CC(C3)Oc4cccc(O)c4 |
|
|
|
|
|
|
| 04010000 01000018 6000010a 00010702 00081000 82000000 02000000 00000200 00110800 000808c0 08140000 4001d040 0480800a 01200000 11001001 00082008 00800000 a2028000 00402000 00020001 00000100 18040610 03000040 00400410 00000000 c0000000 00000008 00000000 00000302 00064002 00000000 00400400 | 04012001 01000008 2010010a 00010602 00001080 00000000 42000000 21000000 00100800 000808c0 08300000 40019000 0580801a 00200000 41081001 00080008 10000000 02000000 00002000 00020a01 00000100 18040630 12000000 81500010 00000000 a0000000 00000000 50000001 04010282 00060002 00002000 00002600 |