On Target NEP_HUMAN 0.48062015/CHEMBL37539
For the given ligand MIe-421, we have found in our database that, being scored 0.48062015, the most similar ligand is CHEMBL37539. Check out the elaboration below.
| MIe-421 (Given Ligand) | CHEMBL37539 (Similar Ligand) |
|---|---|
| NC(=O)C3Oc1ccccc1C2CC23 | OC(=O)CNC(=O)[C@@H](C[C@H](COc1ccccc1)C(=O)O)Cc2ccc(cc2)c3ccccc3 |
|
|
|
|
|
|
| 04010000 01000018 6000010a 00010702 00081000 82000000 02000000 00000200 00110800 000808c0 08140000 4001d040 0480800a 01200000 11001001 00082008 00800000 a2028000 00402000 00020001 00000100 18040610 03000040 00400410 00000000 c0000000 00000008 00000000 00000302 00064002 00000000 00400400 | 04012000 01004208 2010010a 00010700 00081080 02200000 02000000 20000000 00000900 010a08c0 08300000 4001b800 1680803a 01a00000 91080001 000c2008 10820000 02000000 05402008 10020201 00000100 18000e00 13000020 02500018 00000800 80000000 00000000 10000040 00004202 0006000b 20004000 00000600 |