On Target HPGDS_HUMAN 0.24193548/CHEMBL3698265
For the given ligand MIe-421, we have found in our database that, being scored 0.24193548, the most similar ligand is CHEMBL3698265. Check out the elaboration below.
| MIe-421 (Given Ligand) | CHEMBL3698265 (Similar Ligand) |
|---|---|
| NC(=O)C3Oc1ccccc1C2CC23 | CC1C=CC=C1C(=O)N2CCN(CC2)C(=O)NC3CCN(CC3)c4ccc(CCCn5ccnn5)cc4 |
|
|
|
|
|
|
| 04010000 01000018 6000010a 00010702 00081000 82000000 02000000 00000200 00110800 000808c0 08140000 4001d040 0480800a 01200000 11001001 00082008 00800000 a2028000 00402000 00020001 00000100 18040610 03000040 00400410 00000000 c0000000 00000008 00000000 00000302 00064002 00000000 00400400 | 00004002 0104be18 60100100 44010e00 60080000 00002001 04100004 20002408 11100800 101a09e0 08340004 50019800 0402b006 2081a000 00020240 000c000c 20044010 02000100 084900c0 02041201 60120100 38090610 61009021 02500818 00210000 80000000 00480000 90000080 0c008000 800e001b 04100000 04008600 |