On Target ALDR_HUMAN 0.5416667/CHEMBL71562
For the given ligand MIe-421, we have found in our database that, being scored 0.5416667, the most similar ligand is CHEMBL71562. Check out the elaboration below.
| MIe-421 (Given Ligand) | CHEMBL71562 (Similar Ligand) |
|---|---|
| NC(=O)C3Oc1ccccc1C2CC23 | CCC[C@@H]1C[C@@](O)(CC(=O)O)c2cc(F)ccc2O1 |
|
|
|
|
|
|
| 04010000 01000018 6000010a 00010702 00081000 82000000 02000000 00000200 00110800 000808c0 08140000 4001d040 0480800a 01200000 11001001 00082008 00800000 a2028000 00402000 00020001 00000100 18040610 03000040 00400410 00000000 c0000000 00000008 00000000 00000302 00064002 00000000 00400400 | 04010000 01000018 2010010a 02010300 00081000 82004010 06000000 00000a00 00000900 01082840 08100000 50009040 1680802a 02a01000 11000001 00082008 00800000 22008000 01402008 00420001 00000100 08000a20 01001040 02400410 00000800 c0000002 80000000 00000001 00100302 0003c002 40024000 00000600 |