On Target PGH1_SHEEP 0.35106382/CHEMBL12952
For the given ligand MIe-421, we have found in our database that, being scored 0.35106382, the most similar ligand is CHEMBL12952. Check out the elaboration below.
| MIe-421 (Given Ligand) | CHEMBL12952 (Similar Ligand) |
|---|---|
| NC(=O)C3Oc1ccccc1C2CC23 | COc1ccc2cc(ccc2c1)C(C)C(=O)O |
|
|
|
|
|
|
| 04010000 01000018 6000010a 00010702 00081000 82000000 02000000 00000200 00110800 000808c0 08140000 4001d040 0480800a 01200000 11001001 00082008 00800000 a2028000 00402000 00020001 00000100 18040610 03000040 00400410 00000000 c0000000 00000008 00000000 00000302 00064002 00000000 00400400 | 00000000 00000008 20000108 00010200 00001040 00000000 02000000 00000000 00000000 00080840 08000000 40009000 01008002 00000000 41040001 00080008 08000000 02000000 00000000 00020000 00000000 08000a08 01000000 00400010 00000000 80000000 00000000 00000000 00000200 00020002 00002000 00000400 |