On Target P2RX3_HUMAN 0.45061728/CHEMBL3679847
For the given ligand MIe-421, we have found in our database that, being scored 0.45061728, the most similar ligand is CHEMBL3679847. Check out the elaboration below.
| MIe-421 (Given Ligand) | CHEMBL3679847 (Similar Ligand) |
|---|---|
| NC(=O)C3Oc1ccccc1C2CC23 | CSc1ccc(cc1)N2C(C(C(=O)C(C)C)C(=O)C2=O)c3ccccc3OCC4CC4 |
|
|
|
|
|
|
| 04010000 01000018 6000010a 00010702 00081000 82000000 02000000 00000200 00110800 000808c0 08140000 4001d040 0480800a 01200000 11001001 00082008 00800000 a2028000 00402000 00020001 00000100 18040610 03000040 00400410 00000000 c0000000 00000008 00000000 00000302 00064002 00000000 00400400 | 0403c002 01803208 2012010a 00110700 20001000 82002110 06000000 22001608 04100900 001808c0 08380004 7001f040 0e80880a 01300000 91020641 00082008 04040000 22008001 08402018 00020201 c0100140 18048610 21812000 00500419 00001800 c0000080 00000000 90800080 00008302 00064003 24045000 00c10620 |