On Target 5HT2A_HUMAN 0.5940594/CHEMBL2023357
For the given ligand MIe-421, we have found in our database that, being scored 0.5940594, the most similar ligand is CHEMBL2023357. Check out the elaboration below.
| MIe-421 (Given Ligand) | CHEMBL2023357 (Similar Ligand) |
|---|---|
| NC(=O)C3Oc1ccccc1C2CC23 | NC[C@H]1C[C@@H]1c2cc(F)ccc2OCC3CC3 |
|
|
|
|
|
|
| 04010000 01000018 6000010a 00010702 00081000 82000000 02000000 00000200 00110800 000808c0 08140000 4001d040 0480800a 01200000 11001001 00082008 00800000 a2028000 00402000 00020001 00000100 18040610 03000040 00400410 00000000 c0000000 00000008 00000000 00000302 00064002 00000000 00400400 | 04000000 01000208 2010010a 02010700 00001000 82000010 02000000 00000200 00100800 000828c0 08100000 50018040 00800002 01201000 11000001 00082008 00000000 22008000 00400000 00420001 00000100 18000000 01001000 00400410 00000000 c0000000 80000000 00000001 00100300 0006c00a 00000000 00000600 |