On Target AGTR2_HUMAN 0.37356323/CHEMBL154057
For the given ligand MIe-421, we have found in our database that, being scored 0.37356323, the most similar ligand is CHEMBL154057. Check out the elaboration below.
| MIe-421 (Given Ligand) | CHEMBL154057 (Similar Ligand) |
|---|---|
| NC(=O)C3Oc1ccccc1C2CC23 | COc1ccc2CN(C(Cc2c1OCc3ccccc3)C(=O)O)C(=O)C(C4CCCC4)c5ccccc5 |
|
|
|
|
|
|
| 04010000 01000018 6000010a 00010702 00081000 82000000 02000000 00000200 00110800 000808c0 08140000 4001d040 0480800a 01200000 11001001 00082008 00800000 a2028000 00402000 00020001 00000100 18040610 03000040 00400410 00000000 c0000000 00000008 00000000 00000302 00064002 00000000 00400400 | 04018008 47805008 2010010a 10210600 000010a0 c0004000 07041000 22001204 00000980 000808c0 08300000 4001b0c0 0780c88a 20210080 c1080481 0208a008 90000200 02008020 00482008 00020201 80020100 18208e30 03004040 81d49418 00004800 c0002001 00224000 90000000 04000302 0187000b 60066000 00002600 |