On Target NOS2_HUMAN 0.384/CHEMBL1762473
For the given ligand MIe-421, we have found in our database that, being scored 0.384, the most similar ligand is CHEMBL1762473. Check out the elaboration below.
| MIe-421 (Given Ligand) | CHEMBL1762473 (Similar Ligand) |
|---|---|
| NC(=O)C3Oc1ccccc1C2CC23 | NCC[C@@H](Oc1cc(Cl)ccc1C#N)c2ccccc2.OC(=O)C(=O)O |
|
|
|
|
|
|
| 04010000 01000018 6000010a 00010702 00081000 82000000 02000000 00000200 00110800 000808c0 08140000 4001d040 0480800a 01200000 11001001 00082008 00800000 a2028000 00402000 00020001 00000100 18040610 03000040 00400410 00000000 c0000000 00000008 00000000 00000302 00064002 00000000 00400400 | 04008004 00000208 20000108 00010600 00001020 02004000 d2000000 00000000 04000900 008808c0 08100000 4000c800 02808006 00010002 01000003 02082008 00600000 22008000 00800000 00020001 40000100 18000b20 05000400 00c01010 00006000 80002000 00040000 00000000 00000300 0006042a 40000000 00020440 |