On Target SCN9A_HUMAN 0.52100843/CHEMBL205258
For the given ligand MIe-421, we have found in our database that, being scored 0.52100843, the most similar ligand is CHEMBL205258. Check out the elaboration below.
| MIe-421 (Given Ligand) | CHEMBL205258 (Similar Ligand) |
|---|---|
| NC(=O)C3Oc1ccccc1C2CC23 | OC(CCc1ccccc1OC(F)(F)F)[C@@H]2CCC[C@H]2C(=O)NCc3ccccc3 |
|
|
|
|
|
|
| 04010000 01000018 6000010a 00010702 00081000 82000000 02000000 00000200 00110800 000808c0 08140000 4001d040 0480800a 01200000 11001001 00082008 00800000 a2028000 00402000 00020001 00000100 18040610 03000040 00400410 00000000 c0000000 00000008 00000000 00000302 00064002 00000000 00400400 | 00050000 01800008 2010010a 00010600 00181010 00000000 02000000 22001200 00000800 000808c0 08300000 48419040 0400880a 00a00000 01000401 00082008 00000000 02000000 00402000 00020201 80000100 18008610 01000048 00500418 00000040 c0000000 00000000 d0000000 02000302 01074003 20060000 00000e00 |