On Target PRGR_HUMAN 0.45185184/CHEMBL373497
For the given ligand MIe-421, we have found in our database that, being scored 0.45185184, the most similar ligand is CHEMBL373497. Check out the elaboration below.
| MIe-421 (Given Ligand) | CHEMBL373497 (Similar Ligand) |
|---|---|
| NC(=O)C3Oc1ccccc1C2CC23 | CC(C)(CC(O)(CN1C=CC(=O)c2ccccc12)C(F)(F)F)c3cccc4CCOc34 |
|
|
|
|
|
|
| 04010000 01000018 6000010a 00010702 00081000 82000000 02000000 00000200 00110800 000808c0 08140000 4001d040 0480800a 01200000 11001001 00082008 00800000 a2028000 00402000 00020001 00000100 18040610 03000040 00400410 00000000 c0000000 00000008 00000000 00000302 00064002 00000000 00400400 | 04001002 01000008 2410410a 00010600 00041041 82000060 02000000 00000240 02100800 c00808c0 08100004 40018040 00808802 00600000 01040041 000c601c 08000000 2200c000 04600000 00020001 40000100 18008018 23800040 a4500410 00000000 c0000000 00000060 90840014 08000300 02074002 00040000 00000600 |