On Target AA2AR_HUMAN 0.34183672/CHEMBL259151
For the given ligand MIe-421, we have found in our database that, being scored 0.34183672, the most similar ligand is CHEMBL259151. Check out the elaboration below.
| MIe-421 (Given Ligand) | CHEMBL259151 (Similar Ligand) |
|---|---|
| NC(=O)C3Oc1ccccc1C2CC23 | CCCN1C(=O)N(C)C(=O)c2[nH]c(cc12)c3ccc(OCC(=O)N4CCC(CC4)c5ccccc5OC)cc3 |
|
|
|
|
|
|
| 04010000 01000018 6000010a 00010702 00081000 82000000 02000000 00000200 00110800 000808c0 08140000 4001d040 0480800a 01200000 11001001 00082008 00800000 a2028000 00402000 00020001 00000100 18040610 03000040 00400410 00000000 c0000000 00000008 00000000 00000302 00064002 00000000 00400400 | 0400202a 01801a08 20100108 12050702 000c10e0 0000e040 02048002 20080200 16400900 d00818e0 0d34000c 7001c040 00809832 00e01000 013e10c1 000c200c 18820000 8280a004 04600000 00620203 c0000180 38068670 33800041 00700418 00040000 c0000000 20028048 10040051 00004304 00468c0b 40080a00 000006a0 |