On Target PGH2_HUMAN 0.5233645/CHEMBL13623
For the given ligand MIe-421, we have found in our database that, being scored 0.5233645, the most similar ligand is CHEMBL13623. Check out the elaboration below.
| MIe-421 (Given Ligand) | CHEMBL13623 (Similar Ligand) |
|---|---|
| NC(=O)C3Oc1ccccc1C2CC23 | CC(C)(C)c1cc(cc2c1OCC2(C)C)C(=O)CCCC3CC3 |
|
|
|
|
|
|
| 04010000 01000018 6000010a 00010702 00081000 82000000 02000000 00000200 00110800 000808c0 08140000 4001d040 0480800a 01200000 11001001 00082008 00800000 a2028000 00402000 00020001 00000100 18040610 03000040 00400410 00000000 c0000000 00000008 00000000 00000302 00064002 00000000 00400400 | 04011000 01000808 2000010b 00010200 00001041 82000000 02040000 00000240 00000800 00080a40 08100000 40009000 0480800a 01200000 01040001 08082018 08000000 22008000 04002000 00020001 00000100 08020200 01000000 00400014 00000000 c0000000 00120000 00800004 00000302 00020002 80020000 00000400 |