On Target TLR4_HUMAN 0.4121212/CHEMBL3261254
For the given ligand MIe-421, we have found in our database that, being scored 0.4121212, the most similar ligand is CHEMBL3261254. Check out the elaboration below.
| MIe-421 (Given Ligand) | CHEMBL3261254 (Similar Ligand) |
|---|---|
| NC(=O)C3Oc1ccccc1C2CC23 | COc1cc(cc(OC)c1OC)[C@@H]2[C@@H](C3CC3)[C@H]4[C@@H]2C5=C(OC4(C)C)c6ccccc6N(C)C5=O |
|
|
|
|
|
|
| 04010000 01000018 6000010a 00010702 00081000 82000000 02000000 00000200 00110800 000808c0 08140000 4001d040 0480800a 01200000 11001001 00082008 00800000 a2028000 00402000 00020001 00000100 18040610 03000040 00400410 00000000 c0000000 00000008 00000000 00000302 00064002 00000000 00400400 | 04000003 43006018 2800410a 00810710 000c1102 c2000060 42042000 00000208 06400800 400808e0 0c100004 40018040 0080c806 21e00810 11100041 080ca40c 40800000 a2008004 00682400 00060a01 40000100 18108018 21800040 88700414 00040041 c0000000 08120080 00000040 10400302 1406404a 00060000 00200500 |