On Target CNR2_HUMAN 0.71153843/CHEMBL3416120
For the given ligand MIe-421, we have found in our database that, being scored 0.71153843, the most similar ligand is CHEMBL3416120. Check out the elaboration below.
| MIe-421 (Given Ligand) | CHEMBL3416120 (Similar Ligand) |
|---|---|
| NC(=O)C3Oc1ccccc1C2CC23 | CC1(C)Oc2cc(cc(O)c2[C@@H]3C[C@H](O)CC[C@@H]13)[C@@]45CC6CC(C[C@](C6)(C4)C(=O)N)C5 |
|
|
|
|
|
|
| 04010000 01000018 6000010a 00010702 00081000 82000000 02000000 00000200 00110800 000808c0 08140000 4001d040 0480800a 01200000 11001001 00082008 00800000 a2028000 00402000 00020001 00000100 18040610 03000040 00400410 00000000 c0000000 00000008 00000000 00000302 00064002 00000000 00400400 | 04010001 43000018 2000010a 00010700 00081000 c2000000 42000000 00000200 00100900 000808c0 08100000 40019840 0480800a 22a00080 11000001 00082008 00800000 22008000 02482000 00020a01 00000100 18000610 01000040 00400410 00000000 c0000000 00000000 00000000 00010302 00074002 00020000 00400400 |