On Target NTRK1_HUMAN 0.34761906/CHEMBL444109
For the given ligand MIe-421, we have found in our database that, being scored 0.34761906, the most similar ligand is CHEMBL444109. Check out the elaboration below.
| MIe-421 (Given Ligand) | CHEMBL444109 (Similar Ligand) |
|---|---|
| NC(=O)C3Oc1ccccc1C2CC23 | CC(=CCC[C@@]1(C)Oc2c(CC=C(C)C)c3O[C@@]45C6C[C@@H](C=C4C(=O)c3c(O)c2C=C1)C(=O)[C@]5(C\C=C(\C)/C(=O)N)OC6(C)C)C |
|
|
|
|
|
|
| 04010000 01000018 6000010a 00010702 00081000 82000000 02000000 00000200 00110800 000808c0 08140000 4001d040 0480800a 01200000 11001001 00082008 00800000 a2028000 00402000 00020001 00000100 18040610 03000040 00400410 00000000 c0000000 00000008 00000000 00000302 00064002 00000000 00400400 | 04050051 81000838 22801b0b 80210702 00281041 82a20800 c22402c1 08000642 05042854 019a0a48 48140200 4000d060 1682802a 00a00000 11280407 0808b108 20800400 a2108124 1361201e 0202a801 00040120 18021680 0500a061 0a400014 01201400 c0000400 00526a08 c0800420 00414302 80274002 a4020000 00000410 |